2,4-Dibromoaniline
- Product Name2,4-Dibromoaniline
- CAS615-57-6
- MFC6H5Br2N
- MW250.92
- EINECS210-434-4
- MOL File615-57-6.mol
Chemical Properties
| Melting point | 78-80 °C (lit.) |
| Boiling point | 156 °C (24 mmHg) |
| Density | 2.26 |
| refractive index | 1.5800 (estimate) |
| Flash point | 156°C/24mm |
| storage temp. | Store below +30°C. |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| pka | 1.83±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 2206653 |
| InChI | InChI=1S/C6H5Br2N/c7-4-1-2-6(9)5(8)3-4/h1-3H,9H2 |
| InChIKey | DYSRXWYRUJCNFI-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Br)C=C1Br |
| CAS DataBase Reference | 615-57-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 2,4-dibromo-(615-57-6) |
| EPA Substance Registry System | 2,4-Dibromoaniline (615-57-6) |
Safety Information
| Hazard Codes | Xn,Xi,N,T |
| Risk Statements | 36/37/38-33-20/21/22-51/53-25 |
| Safety Statements | 36/37/39-26-61-45 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214210 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |