1,3-Bis(bromomethyl)benzene
- Product Name1,3-Bis(bromomethyl)benzene
- CAS626-15-3
- MFC8H8Br2
- MW263.96
- EINECS210-931-6
- MOL File626-15-3.mol
Chemical Properties
| Melting point | 74-77 °C(lit.) |
| Boiling point | 135-140 °C20 mm Hg(lit.) |
| Density | 1.9590 |
| refractive index | 1.6113 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | dioxane: 0.1 g/mL, clear, colorless |
| form | Crystalline Powder and Chunks |
| color | White to brown |
| Water Solubility | Insoluble in water. |
| BRN | 971085 |
| InChI | InChI=1S/C8H8Br2/c9-5-7-2-1-3-8(4-7)6-10/h1-4H,5-6H2 |
| InChIKey | OXHOPZLBSSTTBU-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=CC(CBr)=C1 |
| CAS DataBase Reference | 626-15-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,3-bis(bromomethyl)-(626-15-3) |
| EPA Substance Registry System | 1,3-Bis(bromomethyl)benzene (626-15-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36/37 |
| RIDADR | UN 3448 6.1/PG 2 |
| WGK Germany | 3 |
| F | 8-19-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29036990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
