4-Fluoro-2-iodotoluene
- Product Name4-Fluoro-2-iodotoluene
- CAS13194-67-7
- MFC7H6FI
- MW236.03
- EINECS236-153-7
- MOL File13194-67-7.mol
Chemical Properties
| Boiling point | 92-94 °C15 mm Hg(lit.) |
| Density | 1.752 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 188 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Orange to Green |
| Sensitive | Light Sensitive |
| BRN | 2242594 |
| InChI | InChI=1S/C7H6FI/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
| InChIKey | RZGYAMQMAVTAKP-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(F)C=C1I |
| CAS DataBase Reference | 13194-67-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xi |
| Risk Statements | 25-52/53-36/37/38 |
| Safety Statements | 45-37/39-26 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
