2-Fluoro-6-iodotoluene
- Product Name2-Fluoro-6-iodotoluene
- CAS443-85-6
- MFC7H6FI
- MW236.03
- EINECS
- MOL File443-85-6.mol
Chemical Properties
| Boiling point | 117 °C/9 mmHg (lit.) |
| Density | 1.8080 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 184 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C7H6FI/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| InChIKey | MSPXWJMFEVAKHQ-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(I)=C1C |
| CAS DataBase Reference | 443-85-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 22-41-51/53 |
| Safety Statements | 26-39-61 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |