Diphenyl(trimethylsilyl)phosphine
- Product NameDiphenyl(trimethylsilyl)phosphine
- CAS17154-34-6
- MFC15H19PSi
- MW258.37
- EINECS
- MOL File17154-34-6.mol
Chemical Properties
| Boiling point | 119-120 °C0.2 mm Hg(lit.) |
| Density | 1.009 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 50 °F |
| form | liquid |
| Specific Gravity | 1.009 |
| Hydrolytic Sensitivity | 9: reacts extremely rapidly with atmospheric moisture - may be pyrophoric - glove box or sealed system required |
| InChI | 1S/C15H19PSi/c1-17(2,3)16(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,1-3H3 |
| InChIKey | WTWVGNUJAAOVSC-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)P(c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 17154-34-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Diphenyl(trimethylsilyl)phosphine(17154-34-6) |
Safety Information
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 16 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 3.1 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 |
