Iron(III) 2-ethylhexanoate
- Product NameIron(III) 2-ethylhexanoate
- CAS7321-53-1
- MFC24H45FeO6
- MW485.4555
- EINECS230-794-6
- MOL File7321-53-1.mol
Chemical Properties
| Boiling point | 400℃[at 101 325 Pa] |
| Density | 0.91 |
| Flash point | 41℃ |
| storage temp. | Refrigerator |
| form | Liquid |
| Water Solubility | Miscible with chloroform. Immiscible with water. |
| Exposure limits | ACGIH: TWA 100 ppm OSHA: TWA 500 ppm(2900 mg/m3) NIOSH: IDLH 20000 mg/m3; TWA 350 mg/m3; Ceiling 1800 mg/m3 |
| InChI | InChI=1S/3C8H16O2.Fe/c3*1-3-5-6-7(4-2)8(9)10;/h3*7H,3-6H2,1-2H3,(H,9,10);/q;;;+3/p-3 |
| InChIKey | ULUYRVWYCIOFRV-UHFFFAOYSA-K |
| SMILES | [Fe](OC(=O)C(CC)CCCC)(OC(=O)C(CC)CCCC)OC(=O)C(CC)CCCC |
| LogP | 5.59 at 20℃ |
| EPA Substance Registry System | Ferric 2-ethylhexanoate (7321-53-1) |
