Copper bis(2-ethylhexanoate)
- Product NameCopper bis(2-ethylhexanoate)
- CAS149-11-1
- MFC16H30CuO4
- MW349.95
- EINECS205-731-0
- MOL File149-11-1.mol
Chemical Properties
| Melting point | 252 °C (dec.)(lit.) |
| storage temp. | Storage temp. 2-8°C |
| form | Powder |
| color | blue |
| Water Solubility | Soluble in water, alcohols, dichloroethane, chlorobenzene, and most organic solvents. |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: IDLH 100 mg/m3; TWA 1 mg/m3 |
| InChI | InChI=1S/2C8H16O2.Cu/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | SEKCXMNFUDONGJ-UHFFFAOYSA-L |
| SMILES | C(CC)(CCCC)C(=O)O[Cu]OC(=O)C(CC)CCCC |
| CAS DataBase Reference | 149-11-1(CAS DataBase Reference) |
| EPA Substance Registry System | Cupric 2-ethylhexanoate (149-11-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B |
