Fenpropimorph
- Product NameFenpropimorph
- CAS67564-91-4
- MFC20H33NO
- MW303.48
- EINECS266-719-9
- MOL File67564-91-4.mol
Chemical Properties
| Melting point | 25°C |
| Boiling point | 444.4°C (rough estimate) |
| Density | 0.9804 (rough estimate) |
| vapor pressure | 0.004Pa at 20℃ |
| refractive index | 1.5614 (estimate) |
| Flash point | >100 °C |
| storage temp. | Store at -20°C |
| solubility | DMF: 15 mg/ml,DMSO: 5 mg/ml,Ethanol: 15 mg/ml,Ethanol:PBS (pH 7.2)(1:2): 0.3 mg/ml |
| form | A neat oil |
| pka | 7.34±0.10(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | 4.32mg/L at 20℃ |
| Merck | 13,4021 |
| Henry's Law Constant | 6.2×100 mol/(m3Pa) at 25℃, Mackay et al. (2006) |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C20H33NO/c1-15(12-21-13-16(2)22-17(3)14-21)11-18-7-9-19(10-8-18)20(4,5)6/h7-10,15-17H,11-14H2,1-6H3 |
| InChIKey | RYAUSSKQMZRMAI-UHFFFAOYSA-N |
| SMILES | CC(CN1CC(C)OC(C)C1)Cc2ccc(cc2)C(C)(C)C |
Safety Information
| Hazard Codes | Xn;N,N,Xn |
| Risk Statements | 22-38-51/53-63 |
| Safety Statements | 36/37-46-61 |
| RIDADR | UN 3082 |
| WGK Germany | WGK 3 |
| RTECS | QE1940000 |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 2 Repr. 2 Skin Irrit. 2 |