| Melting point |
118-120 °C (lit.) |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| form |
Crystalline Powder or Crystals or Crystals |
| color |
Orange to red to brown |
| Water Solubility |
INSOLUBLE |
| Sensitive |
Air Sensitive |
| λmax |
314nm(DMF aq.)(lit.) |
| Exposure limits |
ACGIH: TWA 1 mg/m3
NIOSH: TWA 1 mg/m3 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C6H5O.C5H5.Fe/c7-5-6-3-1-2-4-6;1-2-4-5-3-1;/h1-5H;1-5H; |
| InChIKey |
UQTCQJVPLIVCAX-UHFFFAOYSA-N |
| SMILES |
[C]1(C=O)[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe] |^1:0,3,4,5,6,7,8,9,10,11| |
| EPA Substance Registry System |
Ferrocenecarboxaldehyde (12093-10-6) |
