| Melting point |
124-127 °C(lit.) |
| Boiling point |
454.02°C (rough estimate) |
| Density |
1.14 g/mL at 140 °C (specific gravity)(lit.) |
| vapor pressure |
9.998hPa at 21.1℃ |
| refractive index |
1.5486 (estimate) |
| storage temp. |
2-8°C, protect from light |
| solubility |
almost transparency in Acetone |
| pka |
2.61±0.10(Predicted) |
| form |
powder (Granular) |
| color |
White to Yellow to Orange |
| Water Solubility |
4mg/L at 25℃ |
| InChI |
1S/C17H18N2O4/c18-14-6-2-12(3-7-14)16(20)22-10-1-11-23-17(21)13-4-8-15(19)9-5-13/h2-9H,1,10-11,18-19H2 |
| InChIKey |
YPACMOORZSDQDQ-UHFFFAOYSA-N |
| SMILES |
Nc1ccc(cc1)C(=O)OCCCOC(=O)c2ccc(N)cc2 |
| LogP |
2.63 at 25℃ |
| CAS DataBase Reference |
57609-64-0(CAS DataBase Reference) |
| EPA Substance Registry System |
1,3-Propanediol, bis(4-aminobenzoate) (57609-64-0) |
