| Melting point |
230 °C (dec.)(lit.) |
| Density |
0.981 g/mL at 25 °C |
| storage temp. |
Store at +15°C to +25°C. |
| solubility |
H2O: soluble1mg/mL |
| form |
Solid |
| pka |
4.7(at 25℃) |
| color |
Green |
| PH Range |
4(Yellow)-5.6(Blue) |
| Odor |
Characteristic odour |
| Water Solubility |
Soluble in water and ethanol. |
| ε(extinction coefficient) |
≥10000 at 306-312nm
≥8000 at 397-403nm |
| λmax |
617nm, 400nm |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
Colloidal pigments |
| InChI |
1S/C21H14Br4O5S.Na/c1-9-12(7-14(22)19(26)17(9)24)21(13-8-15(23)20(27)18(25)10(13)2)11-5-3-4-6-16(11)31(28,29)30-21;/h3-8,26-27H,1-2H3;/q;+1/p-1 |
| InChIKey |
HEFSGAHJDGZCHA-UHFFFAOYSA-M |
| SMILES |
[Na+].Cc1c(Br)c(O)c(Br)cc1\C(=C2\C=C(Br)C(=O)C(Br)=C2C)c3ccccc3S([O-])(=O)=O |
| CAS DataBase Reference |
62625-32-5(CAS DataBase Reference) |
| EPA Substance Registry System |
Phenol, 4,4'-(2,2-dioxido-3H-1,2-benzoxathiol-3-ylidene)bis[2,6-dibromo-3-methyl-, monosodium salt (62625-32-5) |
