![(S)-(+)-2-[Hydroxy(diphenyl)methyl]-1-methylpyrrolidine Structure](/CAS/GIF/110529-22-1.gif)
(S)-(+)-2-[Hydroxy(diphenyl)methyl]-1-methylpyrrolidine
- Product Name(S)-(+)-2-[Hydroxy(diphenyl)methyl]-1-methylpyrrolidine
- CAS110529-22-1
- MFC18H21NO
- MW267.37
- EINECS634-571-8
- MOL File110529-22-1.mol
Chemical Properties
| Melting point | 66-72 °C |
| alpha | +52° (c=1, CHCl3) |
| Boiling point | 406.8±25.0 °C(Predicted) |
| Density | 1.116±0.06 g/cm3(Predicted) |
| refractive index | 55 ° (C=1, CHCl3) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | sol hexane, benzene, toluene, Et2O, cyclohexane, dichloromethane |
| pka | 13.15±0.29(Predicted) |
| form | Powder |
| color | white to pale-yellow |
| optical activity | [α]20/D +55±3°, c = 1% in chloroform stab. with amylenes |
| BRN | 4749387 |
| InChI | 1S/C18H21NO/c1-19-14-8-13-17(19)18(20,15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2-7,9-12,17,20H,8,13-14H2,1H3/t17-/m0/s1 |
| InChIKey | XIJAGFLYYNXCAB-KRWDZBQOSA-N |
| SMILES | CN1CCC[C@H]1C(O)(c2ccccc2)c3ccccc3 |
| CAS DataBase Reference | 110529-22-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-34 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
![(S)-(+)-2-[HYDROXY(DIPHENYL)METHYL]-1-METHYLPYRROLIDINE pictures](https://img.chemicalbook.com/ProductImageEN/2020-1/Small/146c2f2b-ea93-4382-b6d6-7308ecacb22f.jpg)