| Melting point |
66-72 °C |
| alpha |
+52° (c=1, CHCl3) |
| Boiling point |
406.8±25.0 °C(Predicted) |
| Density |
1.116±0.06 g/cm3(Predicted) |
| refractive index |
55 ° (C=1, CHCl3) |
| storage temp. |
Sealed in dry,2-8°C |
| solubility |
sol hexane, benzene, toluene, Et2O, cyclohexane, dichloromethane |
| pka |
13.15±0.29(Predicted) |
| form |
Powder |
| color |
white to pale-yellow |
| optical activity |
[α]20/D +55±3°, c = 1% in chloroform stab. with amylenes |
| BRN |
4749387 |
| InChI |
1S/C18H21NO/c1-19-14-8-13-17(19)18(20,15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2-7,9-12,17,20H,8,13-14H2,1H3/t17-/m0/s1 |
| InChIKey |
XIJAGFLYYNXCAB-KRWDZBQOSA-N |
| SMILES |
CN1CCC[C@H]1C(O)(c2ccccc2)c3ccccc3 |
| CAS DataBase Reference |
110529-22-1(CAS DataBase Reference) |
| UNSPSC Code |
12352005 |
| NACRES |
NA.22 |