| Melting point |
186-188 °C |
| Boiling point |
273.29°C (rough estimate) |
| Density |
1.1192 (rough estimate) |
| refractive index |
1.6392 (estimate) |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| pka |
6.47±0.43(Predicted) |
| form |
powder to crystal |
| color |
Light yellow to Yellow to Green |
| Water Solubility |
Soluble in water. |
| BRN |
114795 |
| InChI |
InChI=1S/C10H10N2/c1-7-2-3-8-6-9(11)4-5-10(8)12-7/h2-6H,11H2,1H3 |
| InChIKey |
TYJFYUVDUUACKX-UHFFFAOYSA-N |
| SMILES |
N1C2C(=CC(N)=CC=2)C=CC=1C |
| CAS DataBase Reference |
65079-19-8(CAS DataBase Reference) |
| EPA Substance Registry System |
6-Quinolinamine, 2-methyl- (65079-19-8) |
