beta-Estradiol 17-acetate
- Product Namebeta-Estradiol 17-acetate
- CAS1743-60-8
- MFC20H26O3
- MW314.42
- EINECS605-722-5
- MOL File1743-60-8.mol
Chemical Properties
| Melting point | 210 °C |
| Boiling point | 450.5±45.0 °C(Predicted) |
| Density | 1.18±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | 10.26±0.60(Predicted) |
| color | White to Off-White |
| PH | 6.96 at 24.1℃ and 10g/L |
| BRN | 2625732 |
| InChI | 1S/C20H26O3/c1-12(21)23-19-8-7-18-17-5-3-13-11-14(22)4-6-15(13)16(17)9-10-20(18,19)2/h4,6,11,16-19,22H,3,5,7-10H2,1-2H3/t16-,17-,18+,19+,20+/m1/s1 |
| InChIKey | QAHOQNJVHDHYRN-SLHNCBLASA-N |
| SMILES | CC(=O)O[C@H]1CC[C@H]2[C@@H]3CCc4cc(O)ccc4[C@H]3CC[C@]12C |
| LogP | 4 at 25℃ and pH5 |
Safety Information
| Hazard Codes | T |
| Risk Statements | 60-61 |
| Safety Statements | 53-45 |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 1 Repr. 1B |
