Dibutyltin maleate
- Product NameDibutyltin maleate
- CAS78-04-6
- MFC12H20O4Sn
- MW347
- EINECS201-077-5
- MOL File78-04-6.mol
Chemical Properties
| Melting point | 135-140 °C(lit.) |
| Boiling point | 324.1±25.0 °C(Predicted) |
| Density | 1,318 g/cm3 |
| refractive index | 1.502 |
| Flash point | 204°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| Specific Gravity | 1.318 |
| color | Light yellow to Yellow to Orange |
| Hydrolytic Sensitivity | 2: reacts with aqueous acid |
| InChI | InChI=1S/C4H4O4.2C4H9.Sn/c5-3(6)1-2-4(7)8;2*1-3-4-2;/h1-2H,(H,5,6)(H,7,8);2*1,3-4H2,2H3;/q;;;+2/p-2/b2-1-;;; |
| InChIKey | ZBBLRPRYYSJUCZ-GRHBHMESSA-L |
| SMILES | O1C(=O)C=CC(=O)O[Sn]1(CCCC)CCCC |
| CAS DataBase Reference | 78-04-6(CAS DataBase Reference) |
| EPA Substance Registry System | Dibutyltin maleate (78-04-6) |
Safety Information
| Hazard Codes | T+,N,T |
| Risk Statements | 24/25-26-36/37/38-50/53-68-48/25-43-34-23-22-61-60 |
| Safety Statements | 26-28-36/37-45-60-61-36/37/39-22 |
| RIDADR | UN 3146 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | JH4735000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 Muta. 2 Repr. 1B Skin Corr. 1B Skin Sens. 1 STOT RE 1 |
| Toxicity | LDLo oral in mouse: 470mg/kg |
