Fmoc-Lys(biotin)-OH
- Product NameFmoc-Lys(biotin)-OH
- CAS146987-10-2
- MFC31H38N4O6S
- MW594.72
- EINECS
- MOL File146987-10-2.mol
Chemical Properties
| Melting point | 178-180 °C(Solv: methanol (67-56-1); N,N-dimethylformamide (68-12-2)) |
| Boiling point | 936.2±65.0 °C(Predicted) |
| Density | 1.271±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly, Heated) |
| pka | 3.88±0.21(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | 18.6°(C=0.01g/mL, DMSO, 20°C, 589nm) |
| Water Solubility | Slightly soluble in water and dimethyl sulfoxide. |
| Major Application | peptide synthesis |
| InChIKey | OFIBQNGDYNGUEZ-OBXRUURASA-N |
| SMILES | C(O)(=O)[C@H](CCCCNC(=O)CCCC[C@H]1[C@@]2([H])NC(=O)N[C@@]2([H])CS1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 146987-10-2(CAS DataBase Reference) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 2934 99 90 |
| Storage Class | 11 - Combustible Solids |
![(S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-6-(5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamido)hexanoic acid pictures](/ProductImageEN1/2025-08/Small/9669d6bf-9d00-4b91-93d2-950028b78cce.png)