| Melting point |
178-180 °C(Solv: methanol (67-56-1); N,N-dimethylformamide (68-12-2)) |
| Boiling point |
936.2±65.0 °C(Predicted) |
| Density |
1.271±0.06 g/cm3(Predicted) |
| storage temp. |
Inert atmosphere,2-8°C |
| solubility |
DMSO (Slightly, Heated) |
| pka |
3.88±0.21(Predicted) |
| form |
Solid |
| color |
White to Off-White |
| optical activity |
18.6°(C=0.01g/mL, DMSO, 20°C, 589nm) |
| Water Solubility |
Slightly soluble in water and dimethyl sulfoxide. |
| Major Application |
peptide synthesis |
| InChIKey |
OFIBQNGDYNGUEZ-OBXRUURASA-N |
| SMILES |
C(O)(=O)[C@H](CCCCNC(=O)CCCC[C@H]1[C@@]2([H])NC(=O)N[C@@]2([H])CS1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference |
146987-10-2(CAS DataBase Reference) |
| UNSPSC Code |
12352209 |
| NACRES |
NA.26 |
