| Melting point |
152-156 °C (lit.) |
| Boiling point |
398.54°C (rough estimate) |
| Density |
1.0699 (rough estimate) |
| refractive index |
1.5500 (estimate) |
| storage temp. |
2-8°C, protect from light |
| pka |
5+-.0.40(Predicted) |
| form |
powder to crystal |
| color |
Light yellow to Amber to Dark green |
| Appearance |
Yellow Needle-like Crystals |
| λmax |
390 nm (lit.)
390 nm |
| BRN |
4818243 |
| InChI |
1S/C16H17NO2/c1-10-8-14(18)19-16-12-5-3-7-17-6-2-4-11(15(12)17)9-13(10)16/h8-9H,2-7H2,1H3 |
| InChIKey |
XHXMPURWMSJENN-UHFFFAOYSA-N |
| SMILES |
CC1=CC(=O)Oc2c3CCCN4CCCc(cc12)c34 |
| EPA Substance Registry System |
1H,5H,11H-[1]Benzopyrano[6,7,8-ij]quinolizin-11-one, 2,3,6,7-tetrahydro-9-methyl- (41267-76-9) |
