5'-O-Dimethoxytrityl-N-benzoyl-desoxycytidine
- Product Name5'-O-Dimethoxytrityl-N-benzoyl-desoxycytidine
- CAS67219-55-0
- MFC37H35N3O7
- MW633.69
- EINECS266-605-9
- MOL File67219-55-0.mol
Chemical Properties
| Melting point | 119 °C |
| Boiling point | 668.71°C (rough estimate) |
| Density | 1.2234 (rough estimate) |
| refractive index | 58 ° (C=1, MeOH) |
| storage temp. | 2-8°C |
| solubility | DMF: 30 mg/ml,DMSO: 30 mg/ml,Ethanol: 30 mg/ml |
| pka | 8.67±0.20(Predicted) |
| form | powder to crystaline |
| color | White to Almost white |
| Water Solubility | 100μg/L at 20℃ |
| BRN | 601627 |
| InChIKey | MYSNCIZBPUPZMQ-VOTWKOMSSA-N |
| SMILES | C(C1C=CC=CC=1)(C1C=CC(=CC=1)OC)(C1C=CC(=CC=1)OC)OC[C@@H]1[C@H](C[C@H](N2C=CC(=NC2=O)NC(C2C=CC=CC=2)=O)O1)O |
| LogP | 5.3 at 20℃ |
| CAS DataBase Reference | 67219-55-0(CAS DataBase Reference) |
| EPA Substance Registry System | Cytidine, N-benzoyl-5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-deoxy- (67219-55-0) |
Safety Information
| Hazard Codes | Xn,Xi,T |
| Risk Statements | 40-36/37/38-20/21/22-46-45 |
| Safety Statements | 36/37-36-26-22-45-53 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 1 |
| F | 1-3-10 |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 |
