Harpagide
- Product NameHarpagide
- CAS6926-08-5
- MFC15H24O10
- MW364.35
- EINECS230-050-0
- MOL File6926-08-5.mol
Chemical Properties
| Boiling point | 637.1±55.0 °C(Predicted) |
| Density | 1.66±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in methanol and water |
| form | powder |
| pka | 12.10±0.70(Predicted) |
| color | Colorless-light yellow |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | SKIN PROTECTING SKIN CONDITIONING |
| InChI | 1S/C15H24O10/c1-14(21)4-7(17)15(22)2-3-23-13(11(14)15)25-12-10(20)9(19)8(18)6(5-16)24-12/h2-3,6-13,16-22H,4-5H2,1H3/t6-,7-,8-,9+,10-,11-,12+,13+,14+,15-/m1/s1 |
| InChIKey | XUWSHXDEJOOIND-YYDKPPGPSA-N |
| SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)O[C@@H]2OC=C[C@@]3([C@H]2[C@](C[C@H]3O)(O)C)O |
| LogP | -3.690 (est) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
