Oleuropeinic acid
- Product NameOleuropeinic acid
- CAS96382-90-0
- MFC25H30O15
- MW570.5
- EINECS
- MOL File96382-90-0.mol
Chemical Properties
| Boiling point | 869.0±65.0 °C(Predicted) |
| Density | 1.61±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Soluble in DMSO |
| form | Solid |
| pka | 3.77±0.41(Predicted) |
| color | White to off-white |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChIKey | XJDJODWHDUVAGF-HITGIGKYSA-N |
| SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)OC2OC=C(C(\C\2=C/C(=O)O)CC(=O)OCCc3cc(c(cc3)O)O)C(=O)OC |
Safety Information
| Risk Statements | 50 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 |
