Aniline-d7
- Product NameAniline-d7
- CAS14545-23-4
- MFC6D7N
- MW100.17
- EINECS238-580-4
- MOL File14545-23-4.mol
Chemical Properties
| Melting point | -6 °C(lit.) |
| Boiling point | 184 °C(lit.) |
| Density | 1.098 g/mL at 25 °C |
| refractive index | n |
| Flash point | 158 °F |
| storage temp. | 2-8°C |
| Stability | Stable, but light sensitive. May discolour upon exposure to air or light. Incompatible with oxidizing agents, bases, iron, iron salts, aluminium, zinc. |
| InChI | 1S/C6H7N/c7-6-4-2-1-3-5-6/h1-5H,7H2/i1D,2D,3D,4D,5D/hD2 |
| InChIKey | PAYRUJLWNCNPSJ-LQHBDRBESA-N |
| SMILES | [2H]N([2H])c1c([2H])c([2H])c([2H])c([2H])c1[2H] |
| EPA Substance Registry System | Aniline-d7 (14545-23-4) |
| CAS Number Unlabeled | 62-53-3 |
Safety Information
| Hazard Codes | T,N |
| Risk Statements | 20/21/22-40-48/23/24/25-50-68-43-41-23/24/25 |
| Safety Statements | 28-36/37-45-61-36/37/39-26-63-46-27 |
| RIDADR | UN 1547 6.1/PG 2 |
| WGK Germany | 3 |
| HS Code | 28459000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Eye Dam. 1 Muta. 2 Skin Sens. 1 STOT RE 1 |