| Melting point |
93℃/19mm |
| Boiling point |
93-95°C 10mm |
| Density |
0.924 at 25 °C |
| vapor pressure |
0.2-47.329Pa at 11.67-34.92℃ |
| refractive index |
1.4676 (589.3 nm 20℃) |
| Flash point |
88℃ |
| storage temp. |
2-8°C |
| Water Solubility |
Soluble in water |
| form |
Liquid |
| pka |
-0.77±0.70(Predicted) |
| color |
Colorless to Light yellow |
| InChI |
InChI=1S/C7H13NO/c1-4-7(9)8(5-2)6-3/h4H,1,5-6H2,2-3H3 |
| InChIKey |
OVHHHVAVHBHXAK-UHFFFAOYSA-N |
| SMILES |
C(N(CC)CC)(=O)C=C |
| LogP |
0.61-0.84 at 23-30℃ and pH7.17-7.28 |
| Surface tension |
66-67.6mN/m at 1g/L and 20-20.05℃ |
