2,4-Bis(trifluoromethyl)phenylboronic acid
- Product Name2,4-Bis(trifluoromethyl)phenylboronic acid
- CAS153254-09-2
- MFC8H5BF6O2
- MW257.93
- EINECS604-892-8
- MOL File153254-09-2.mol
Chemical Properties
| Melting point | 148-150 |
| Boiling point | 245.4±50.0 °C(Predicted) |
| Density | 1.50±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 7.40±0.58(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C8H5BF6O2/c10-7(11,12)4-1-2-6(9(16)17)5(3-4)8(13,14)15/h1-3,16-17H |
| InChIKey | WLYPBMBWKYALCG-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C(F)(F)F)C=C1C(F)(F)F)(O)O |
| CAS DataBase Reference | 153254-09-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C,Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-24/25 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
| Storage Class | 13 - Non Combustible Solids |
