Chemical Properties
| Melting point | 147-148.5℃ (water , methanol ) |
| Boiling point | 452.6±45.0 °C(Predicted) |
| Density | 1.358±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 7.54±0.20(Predicted) |
| color | White to Off-White |
| BRN | 1347824 |
| Major Application | food and beverages |
| InChI | InChI=1S/C11H10O5/c1-14-10-6-3-4-9(13)16-8(6)5-7(12)11(10)15-2/h3-5,12H,1-2H3 |
| InChIKey | DVBPETFXQYSHLJ-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(O)=C(OC)C(OC)=C2C=C1 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2932209090 |
| Storage Class | 11 - Combustible Solids |