Phallacidin
- Product NamePhallacidin
- CAS26645-35-2
- MFC37H50N8O13S
- MW846.91
- EINECS
- MOL File26645-35-2.mol
Chemical Properties
| Boiling point | 1435.246±65.00 °C(Press: 760.00 Torr)(predicted) |
| Density | 1.1678 (rough estimate) |
| refractive index | 1.7400 (estimate) |
| solubility | DMF: Soluble; DMSO: Soluble; Methanol: Soluble; Water: Soluble |
| form | White to off-white powder. |
| pka | 3.129±0.11(predicted) |
| color | White to off-white |
| Appearance | Solid Powder |
| biological source | Amanita phalloides |
| Sequence | Ala-Trp-Leu-Val-{D-Asp}-Cys-{Hyp} (Sulfide bridge: Trp2- Cys6) |
| InChIKey | KUBDTFZQCYLLGC-UHFFFAOYSA-N |
| SMILES | CC(C)C1NC(=O)C(CC(C)(O)CO)NC(=O)C2Cc3c(SCC(NC(=O)C(NC1=O)C(O)C(O)=O)C(=O)N4CC(O)CC4C(=O)NC(C)C(=O)N2)[nH]c5ccccc35 |
Safety Information
| Hazard Codes | T+ |
| Risk Statements | 26/27/28 |
| Safety Statements | 22-36/37/39-45 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| RTECS | GT8943000 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 2934999090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 2 Dermal Acute Tox. 2 Oral |