| Melting point |
194-196 °C(lit.) |
| Boiling point |
388.24°C (rough estimate) |
| Density |
1.1477 (rough estimate) |
| refractive index |
1.5600 (estimate) |
| storage temp. |
Inert atmosphere,Store in freezer, under -20°C |
| pka |
14.90±0.46(Predicted) |
| form |
powder |
| color |
white to off-white |
| optical activity |
20.32°(C=0.51g/100mI, MEOH, 20°C, 589nm) |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
detection |
| InChI |
InChI=1/C13H15N3O2/c1-8(17)16-12(13(14)18)6-9-7-15-11-5-3-2-4-10(9)11/h2-5,7,12,15H,6H2,1H3,(H2,14,18)(H,16,17)/t12-/s3 |
| InChIKey |
HNGIZKAMDMBRKJ-PLAQIDKDNA-N |
| SMILES |
C12C=CC=CC=1NC=C2C[C@@H](C(=O)N)NC(=O)C |&1:10,r| |
| CAS DataBase Reference |
2382-79-8 |