| Melting point |
132-134°C |
| Boiling point |
274.4±35.0 °C(Predicted) |
| Density |
1.806±0.06 g/cm3(Predicted) |
| Water Solubility |
almost transparency in Water |
| form |
powder to crystal |
| pka |
0.22±0.10(Predicted) |
| color |
White to Almost white |
| Stability |
Stable. Non-flammable. Incompatible with strong bases. |
| InChI |
InChI=1S/C6H2F8O4/c7-3(8,1(15)16)5(11,12)6(13,14)4(9,10)2(17)18/h(H,15,16)(H,17,18) |
| InChIKey |
AXRSOGFYDSXLQX-UHFFFAOYSA-N |
| SMILES |
C(O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(O)=O |
| CAS DataBase Reference |
336-08-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Hexanedioic acid, 2,2,3,3,4,4,5,5-octafluoro- (336-08-3) |
