Octafluoroadipic acid
- Product NameOctafluoroadipic acid
- CAS336-08-3
- CBNumberCB6127899
- MFC6H2F8O4
- MW290.06
- EINECS206-407-1
- MDL NumberMFCD00066405
- MOL File336-08-3.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 132-134°C |
| Boiling point | 274.4±35.0 °C(Predicted) |
| Density | 1.806±0.06 g/cm3(Predicted) |
| Water Solubility | almost transparency in Water |
| form | powder to crystal |
| pka | 0.22±0.10(Predicted) |
| color | White to Almost white |
| Stability | Stable. Non-flammable. Incompatible with strong bases. |
| InChI | InChI=1S/C6H2F8O4/c7-3(8,1(15)16)5(11,12)6(13,14)4(9,10)2(17)18/h(H,15,16)(H,17,18) |
| InChIKey | AXRSOGFYDSXLQX-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(O)=O |
| CAS DataBase Reference | 336-08-3(CAS DataBase Reference) |
| EPA Substance Registry System | Hexanedioic acid, 2,2,3,3,4,4,5,5-octafluoro- (336-08-3) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H401 | |||||||||
| Precautionary statements | P501-P273-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-60-45-28-24/25-22 | |||||||||
| RIDADR | 3261 | |||||||||
| RTECS | MO1925000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | CORROSIVE | |||||||||
| HS Code | 29171900 | |||||||||
| NFPA 704: |
|
