2,2,3,3,4,4,5,5-Octafluoro-1,6-hexanediol
- Product Name2,2,3,3,4,4,5,5-Octafluoro-1,6-hexanediol
- CAS355-74-8
- MFC6H6F8O2
- MW262.1
- EINECS670-345-5
- MOL File355-74-8.mol
Chemical Properties
| Melting point | 66-70 °C(lit.) |
| Boiling point | 100 °C3 mm Hg(lit.) |
| Density | 1.4712 (estimate) |
| Flash point | 100°C/3mm |
| form | powder to crystal |
| pka | 12.62±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Water Solubility | Soluble in water. |
| BRN | 1784039 |
| Stability | Stable. Incompatible with strong bases, strong oxidizing agents. |
| InChI | InChI=1S/C6H6F8O2/c7-3(8,1-15)5(11,12)6(13,14)4(9,10)2-16/h15-16H,1-2H2 |
| InChIKey | NHEKBXPLFJSSBZ-UHFFFAOYSA-N |
| SMILES | C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CO |
| CAS DataBase Reference | 355-74-8(CAS DataBase Reference) |
| EPA Substance Registry System | 1H,1H,6H,6H-Perfluoro-1,6-hexanediol (355-74-8) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 22-24/25-37-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29055900 |
| Storage Class | 11 - Combustible Solids |
