Triethyl 2-phosphonobutyrate
- Product NameTriethyl 2-phosphonobutyrate
- CAS17145-91-4
- MFC10H21O5P
- MW252.24
- EINECS627-866-8
- MOL File17145-91-4.mol
Chemical Properties
| Boiling point | 152-154 °C14 mm Hg(lit.) |
| Density | 1.064 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.064 |
| color | Clear colorless |
| Water Solubility | Not miscible or difficult to mix with water. |
| BRN | 1789280 |
| InChI | InChI=1S/C10H21O5P/c1-5-9(10(11)13-6-2)16(12,14-7-3)15-8-4/h9H,5-8H2,1-4H3 |
| InChIKey | GYUCVQSNZFRDRL-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(P(OCC)(OCC)=O)CC |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29310099 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |