3,4-Dichlorophenacyl bromide
- Product Name3,4-Dichlorophenacyl bromide
- CAS2632-10-2
- MFC8H5BrCl2O
- MW267.93
- EINECS627-992-3
- MOL File2632-10-2.mol
Chemical Properties
| Melting point | 54 °C |
| Boiling point | 339℃ |
| Density | 1.695 |
| Flash point | 159℃ |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 511981 |
| InChI | InChI=1S/C8H5BrCl2O/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3H,4H2 |
| InChIKey | PAKFHEFMTRCFAU-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(Cl)C(Cl)=C1)CBr |
| CAS DataBase Reference | 2632-10-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,T |
| Risk Statements | 20/21/22-34-36/37-36/37/38-36-25 |
| Safety Statements | 26-27-36/37/39-36-45 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |