PIPEROPHOS
- Product NamePIPEROPHOS
- CAS24151-93-7
- MFC14H28NO3PS2
- MW353.48
- EINECS
- MOL File24151-93-7.mol
Chemical Properties
| Melting point | <25℃ |
| Boiling point | 250°C |
| Density | 1.153±0.06 g/cm3(Predicted) |
| Flash point | >100 °C |
| storage temp. | 0-6°C |
| pka | -0.87±0.40(Predicted) |
| form | liquid |
| Water Solubility | 25mg/L(20 ºC) |
| BRN | 8395577 |
| Henry's Law Constant | 8.8×102 mol/(m3Pa) at 25℃, Ebert et al. (2023) |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Major Application | agriculture environmental |
| InChI | 1S/C14H28NO3PS2/c1-4-10-17-19(20,18-11-5-2)21-12-14(16)15-9-7-6-8-13(15)3/h13H,4-12H2,1-3H3 |
| InChIKey | UNLYSVIDNRIVFJ-UHFFFAOYSA-N |
| SMILES | CCCOP(=S)(OCCC)SCC(=O)N1CCCCC1C |
| EPA Substance Registry System | Phosphorodithioic acid, S-[2-(2-methyl-1-piperidinyl)-2-oxoethyl] O,O-dipropyl ester (24151-93-7) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 60-61 |
| RIDADR | 3018 |
| WGK Germany | 3 |
| RTECS | TE3690000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
