IsoaMyl 4-MethoxycinnaMate
- Product NameIsoaMyl 4-MethoxycinnaMate
- CAS71617-10-2
- MFC15H20O3
- MW248.32
- EINECS275-702-5
- MOL File71617-10-2.mol
Chemical Properties
| Boiling point | 158°C/0.7mmHg(lit.) |
| Density | 1.04 |
| vapor pressure | 0.007Pa at 25℃ |
| refractive index | 1.5560 to 1.5600 |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Light yellow to Yellow to Orange |
| Water Solubility | 2.47mg/L at 20℃ |
| BRN | 3132627 |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| Cosmetics Ingredients Functions | LIGHT STABILIZER UV ABSORBER UV FILTER |
| InChI | InChI=1S/C15H20O3/c1-12(2)10-11-18-15(16)9-6-13-4-7-14(17-3)8-5-13/h4-9,12H,10-11H2,1-3H3 |
| InChIKey | UBNYRXMKIIGMKK-UHFFFAOYSA-N |
| SMILES | C(OCCC(C)C)(=O)C=CC1=CC=C(OC)C=C1 |
| LogP | 4.947 at 25℃ |
Safety Information
| WGK Germany | 2 |
| RTECS | UD3393500 |
| HS Code | 29181990 |
| Storage Class | 10 - Combustible liquids |