6-Chlorohexanoic acid
- Product Name6-Chlorohexanoic acid
- CAS4224-62-8
- MFC6H11ClO2
- MW150.6
- EINECS700-529-3
- MOL File4224-62-8.mol
Chemical Properties
| Melting point | 26°C |
| Boiling point | 138-140℃ (10 Torr) |
| Density | 1.1320 g/cm3 |
| refractive index | 1.4680 (589.3 nm 20℃) |
| Flash point | 26 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Soluble), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | powder to lump to clear liquid |
| pka | 4.73±0.10(Predicted) |
| color | White or Colorless to Light yellow |
| InChI | InChI=1S/C6H11ClO2/c7-5-3-1-2-4-6(8)9/h1-5H2,(H,8,9) |
| InChIKey | XWWKSLXUVZVGSP-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCCCl |
| CAS DataBase Reference | 4224-62-8(CAS DataBase Reference) |
Safety Information
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3265 |
| RTECS | MO7000000 |
| HazardClass | 8 |
| PackingGroup | Ⅲ |
| HS Code | 2915907098 |
