| Melting point |
-59°C |
| Boiling point |
245-246°C |
| Density |
0,891 g/cm3 |
| vapor pressure |
0.27Pa at 20℃ |
| refractive index |
1.3948 |
| Flash point |
75°C |
| storage temp. |
2-8°C |
| solubility |
soluble in Benzene |
| form |
liquid |
| Specific Gravity |
0.8910 |
| color |
Colorless to Almost colorless |
| Water Solubility |
2.3ng/L at 20℃ |
| Hydrolytic Sensitivity |
1: no significant reaction with aqueous systems |
| Henry's Law Constant |
2.7×10-8 mol/(m3Pa) at 25℃, Mazzoni et al. (1997) |
| InChI |
1S/C14H42O5Si6/c1-20(2,3)15-22(7,8)17-24(11,12)19-25(13,14)18-23(9,10)16-21(4,5)6/h1-14H3 |
| InChIKey |
ADANNTOYRVPQLJ-UHFFFAOYSA-N |
| SMILES |
[Si](O[Si](O[Si](O[Si](C)(C)C)(C)C)(C)C)(O[Si](O[Si](C)(C)C)(C)C)(C)C |
| LogP |
9.41 at 25℃ |
| EPA Substance Registry System |
Hexasiloxane, tetradecamethyl- (107-52-8) |
