| Melting point |
?68 °C (lit.) |
| Boiling point |
194 °C (lit.) |
| Density |
0.854 g/mL at 25 °C (lit.) |
| vapor density |
>1 (vs air) |
| vapor pressure |
73Pa at 25℃ |
| refractive index |
n20/D 1.389(lit.) |
| Flash point |
144 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
<0.1mg/l |
| form |
liquid |
| Specific Gravity |
0.854 |
| color |
Colourless to Pale Yellow |
| Water Solubility |
6.74μg/L at 23℃ |
| Hydrolytic Sensitivity |
1: no significant reaction with aqueous systems |
| Merck |
14,2850 |
| BRN |
1776881 |
| Henry's Law Constant |
1.4×10-7 mol/(m3Pa) at 25℃, Xu and Kropscott (2014) |
| Dielectric constant |
2.4(20℃) |
| Stability |
Moisture Sensitive |
| Cosmetics Ingredients Functions |
ANTIFOAMING |
| InChI |
1S/C10H30O3Si4/c1-14(2,3)11-16(7,8)13-17(9,10)12-15(4,5)6/h1-10H3 |
| InChIKey |
YFCGDEUVHLPRCZ-UHFFFAOYSA-N |
| SMILES |
C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| LogP |
8.21 at 25.1℃ |
| CAS DataBase Reference |
141-62-8(CAS DataBase Reference) |
| NIST Chemistry Reference |
Tetrasiloxane, decamethyl-(141-62-8) |
| EPA Substance Registry System |
Tetrasiloxane, decamethyl- (141-62-8) |
