1-Methyl-4-(methylsulfonyl)-benzene
- Product Name1-Methyl-4-(methylsulfonyl)-benzene
- CAS3185-99-7
- MFC8H10O2S
- MW170.23
- EINECS221-682-8
- MOL File3185-99-7.mol
Chemical Properties
| Melting point | 85-89 °C(lit.) |
| Boiling point | 140 °C / 3mmHg |
| Density | 1.2238 (rough estimate) |
| refractive index | 1.5320 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 607296 |
| InChI | InChI=1S/C8H10O2S/c1-7-3-5-8(6-4-7)11(2,9)10/h3-6H,1-2H3 |
| InChIKey | YYDNBUBMBZRNQQ-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(S(C)(=O)=O)C=C1 |
| CAS DataBase Reference | 3185-99-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-methyl-4-(methylsulfonyl)-(3185-99-7) |
| EPA Substance Registry System | Benzene, 1-methyl-4-(methylsulfonyl)- (3185-99-7) |
Safety Information
| Hazard Codes | Xn,F |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 1 |
| HazardClass | IRRITANT |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
