Imperatorin
- Product NameImperatorin
- CAS482-44-0
- MFC16H14O4
- MW270.28
- EINECS207-581-1
- MOL File482-44-0.mol
Chemical Properties
| Melting point | 98-100°C |
| Boiling point | 333.4°C (rough estimate) |
| Density | 1.1311 (rough estimate) |
| refractive index | 1.4350 (estimate) |
| storage temp. | -20°C |
| solubility | DMSO: ≥5mg/mL |
| form | powder |
| color | off-white to light brown |
| λmax | 301nm(MeOH)(lit.) |
| Merck | 14,4925 |
| Major Application | food and beverages |
| InChI | InChI=1S/C16H14O4/c1-10(2)5-7-19-16-14-12(6-8-18-14)9-11-3-4-13(17)20-15(11)16/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | OLOOJGVNMBJLLR-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=C(OC/C=C(\C)/C)C3OC=CC=3C=C2C=C1 |
| LogP | 2.983 (est) |
| CAS DataBase Reference | 482-44-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 7H-furo[3,2-g][1]benzopyran-7-one, 9-[(3-methyl-2-butenyl)oxy]-(482-44-0) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | LV1575000 |
| HS Code | 29419090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Hazardous Substances Data | 482-44-0(Hazardous Substances Data) |
