2,6-Dichlorostyrene
- Product Name2,6-Dichlorostyrene
- CAS28469-92-3
- MFC8H6Cl2
- MW173.04
- EINECS249-039-7
- MOL File28469-92-3.mol
Chemical Properties
| Melting point | 89°C |
| Boiling point | 88-90 °C/8 mmHg (lit.) |
| Density | 1.267 g/mL at 25 °C (lit.) |
| RTECS | CZ4907000 |
| refractive index | 1.573-1.575 |
| Flash point | 71 °C |
| storage temp. | 2-8°C |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Immiscible with water. |
| BRN | 1931527 |
| InChI | InChI=1S/C8H6Cl2/c1-2-6-7(9)4-3-5-8(6)10/h2-5H,1H2 |
| InChIKey | YJCVRMIJBXTMNR-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=CC(Cl)=C1C=C |
| CAS DataBase Reference | 28469-92-3(CAS DataBase Reference) |
| EPA Substance Registry System | 2,6-Dichlorostyrene (28469-92-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |
