2-BROMO-4,6-DIMETHYLANILINE
- Product Name2-BROMO-4,6-DIMETHYLANILINE
- CAS41825-73-4
- MFC8H10BrN
- MW200.08
- EINECS609-959-5
- MOL File41825-73-4.mol
Chemical Properties
| Melting point | 43-47 °C (lit.) |
| Boiling point | 75-79°C 5mm |
| Density | 1.424 |
| refractive index | 1.5748 (estimate) |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2.82±0.10(Predicted) |
| form | powder to crystal |
| color | Amber to Dark green to Black |
| Water Solubility | Insoluble in water. |
| BRN | 3046484 |
| InChI | InChI=1S/C8H10BrN/c1-5-3-6(2)8(10)7(9)4-5/h3-4H,10H2,1-2H3 |
| InChIKey | YOSJCQJJIHEUKA-UHFFFAOYSA-N |
| SMILES | C1(N)=C(C)C=C(C)C=C1Br |
| CAS DataBase Reference | 41825-73-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Bromo-4,6-dimethylaniline (41825-73-4) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
