3-Bromo-N,N-dimethylaniline
- Product Name3-Bromo-N,N-dimethylaniline
- CAS16518-62-0
- MFC8H10BrN
- MW200.08
- EINECS605-393-8
- MOL File16518-62-0.mol
Chemical Properties
| Melting point | 11°C |
| Boiling point | 126°C 14mm |
| Density | 1.402 g/mL at 25 °C |
| refractive index | 1.6004 |
| Flash point | 126°C/14mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Miscible with chloroform, dichloromethane and methanol. |
| pka | 3.90±0.10(Predicted) |
| form | liquid |
| color | Yellow |
| BRN | 2079908 |
| InChI | InChI=1S/C8H10BrN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
| InChIKey | USEXQPWLCGBYNT-UHFFFAOYSA-N |
| SMILES | C1(N(C)C)=CC=CC(Br)=C1 |
| CAS DataBase Reference | 16518-62-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-33 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2921420090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Eye Irrit. 2 STOT RE 2 |
