2-Bromo-4,6-dimethylaniline
- Product Name2-Bromo-4,6-dimethylaniline
- CAS41825-73-4
- CBNumberCB5229976
- MFC8H10BrN
- MW200.08
- EINECS609-959-5
- MDL NumberMFCD00047826
- MOL File41825-73-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 43-47 °C (lit.) |
| Boiling point | 75-79°C 5mm |
| Density | 1.424 |
| refractive index | 1.5748 (estimate) |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2.82±0.10(Predicted) |
| form | powder to crystal |
| color | Amber to Dark green to Black |
| Water Solubility | Insoluble in water. |
| BRN | 3046484 |
| InChI | InChI=1S/C8H10BrN/c1-5-3-6(2)8(10)7(9)4-5/h3-4H,10H2,1-2H3 |
| InChIKey | YOSJCQJJIHEUKA-UHFFFAOYSA-N |
| SMILES | C1(N)=C(C)C=C(C)C=C1Br |
| CAS DataBase Reference | 41825-73-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Bromo-4,6-dimethylaniline (41825-73-4) |
| UNSPSC Code | 12352100 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 6.1 | |||||||||
| HS Code | 29214990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
