4-Bromo-2,6-dimethylaniline
- Product Name4-Bromo-2,6-dimethylaniline
- CAS24596-19-8
- CBNumberCB0250184
- MFC8H10BrN
- MW200.08
- EINECS246-337-9
- MDL NumberMFCD00007826
- MOL File24596-19-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 48-51 °C (lit.) |
| Boiling point | 120°C 0,2mm |
| Density | 1.4423 (rough estimate) |
| refractive index | 1.5748 (estimate) |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform, Methanol |
| pka | 3.60±0.10(Predicted) |
| form | Liquid |
| color | Clear yellow to orange to amber |
| BRN | 1936300 |
| InChI | InChI=1S/C8H10BrN/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,10H2,1-2H3 |
| InChIKey | QGLAYJCJLHNIGJ-UHFFFAOYSA-N |
| SMILES | C1(N)=C(C)C=C(Br)C=C1C |
| CAS DataBase Reference | 24596-19-8(CAS DataBase Reference) |
| FDA UNII | 9W5K8J5F6B |
| NIST Chemistry Reference | Benzenamine, 4-bromo-2,6-dimethyl-(24596-19-8) |
| UNSPSC Code | 12352100 |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H311+H331-H315-H335-H351-H410 | |||||||||
| Precautionary statements | P273-P280-P301+P312-P302+P352+P312-P304+P340+P311-P308+P313 | |||||||||
| Hazard Codes | Xi,Xn | |||||||||
| Risk Statements | 38-43-36/37/38-20/21/22 | |||||||||
| Safety Statements | 36/37-36/37/39-26 | |||||||||
| RIDADR | UN2811/6.1/III | |||||||||
| WGK Germany | 3 | |||||||||
| F | 8-10-23 | |||||||||
| Hazard Note | Harmful | |||||||||
| HazardClass | 6.1 | |||||||||
| HS Code | 29214990 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
