2,3,4-Trihydroxybenzophenone
- Product Name2,3,4-Trihydroxybenzophenone
- CAS1143-72-2
- MFC13H10O4
- MW230.22
- EINECS214-540-1
- MOL File1143-72-2.mol
Chemical Properties
| Melting point | 139-141 °C (lit.) |
| Boiling point | 439.7±45.0 °C(Predicted) |
| Density | 1.413±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | ethanol: soluble2%, clear, yellow to very dark yellow-orange |
| pka | 7.51±0.40(Predicted) |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| PH | 6-7 (H2O) |
| Water Solubility | 13.22g/L(24.99 ºC) |
| BRN | 2697065 |
| InChI | 1S/C13H10O4/c14-10-7-6-9(12(16)13(10)17)11(15)8-4-2-1-3-5-8/h1-7,14,16-17H |
| InChIKey | HTQNYBBTZSBWKL-UHFFFAOYSA-N |
| SMILES | Oc1ccc(c(O)c1O)C(=O)c2ccccc2 |
| LogP | 2.8 at 23℃ |
| CAS DataBase Reference | 1143-72-2(CAS DataBase Reference) |
| EPA Substance Registry System | Methanone, phenyl(2,3,4-trihydroxyphenyl)- (1143-72-2) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |