Bromoacetic acid-d3
- Product NameBromoacetic acid-d3
- CAS14341-48-1
- MFC2BrD3O2
- MW141.97
- EINECS
- MOL File14341-48-1.mol
Chemical Properties
| Melting point | 47-49 °C (lit.) |
| Boiling point | 208 °C (lit.) |
| Flash point | >230 °F |
| storage temp. | Hygroscopic, Refrigerator, Under inert atmosphere |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Low-Melting Solid |
| color | White to Off-White |
| Stability | Hygroscopic |
| InChI | 1S/C2H3BrO2/c3-1-2(4)5/h1H2,(H,4,5)/i1D2/hD |
| InChIKey | KDPAWGWELVVRCH-RIAYTAFFSA-N |
| SMILES | [2H]OC(=O)C([2H])([2H])Br |
Safety Information
| Hazard Codes | T,C,N |
| Risk Statements | 23/24/25-35-50-43 |
| Safety Statements | 26-36/37/39-45-61 |
| RIDADR | UN 3425 8/PG 2 |
| WGK Germany | 2 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Aquatic Acute 1 Eye Dam. 1 Skin Corr. 1A Skin Sens. 1 |