Methylprednisolone sodium succinate
- Product NameMethylprednisolone sodium succinate
- CAS2375-03-3
- MFC26H33O8.Na
- MW497.53
- EINECS219-156-8
- MOL File2375-03-3.mol
Chemical Properties
| Melting point | >186°C (dec.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | lyophilized powder |
| pka | 4.5 |
| color | White to Off-White |
| biological source | synthetic |
| Water Solubility | water: 50mg/mL, clear, colorless to faintly yellow |
| InChIKey | FQISKWAFAHGMGT-JXAFMBTDNA-M |
| SMILES | [C@]12(C[C@@H](C3=CC(=O)C=C[C@]3(C)[C@@]1([H])[C@H](C[C@]1(C)[C@@](CC[C@@]21[H])(O)C(=O)COC(=O)CCC([O-])=O)O)C)[H].[Na+] |&1:0,2,9,11,13,15,17,20,r| |
| CAS DataBase Reference | 2375-03-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 61-40 |
| Safety Statements | 53-22-36/37/39-45 |
| WGK Germany | 3 |
| RTECS | TU4154060 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 2 Repr. 1B |
| Toxicity | LD50 oral in rat: > 5gm/kg |
