Amodiaquin dihydrochloride dihydrate
- Product NameAmodiaquin dihydrochloride dihydrate
- CAS6398-98-7
- MFC20H25Cl2N3O2
- MW410.34
- EINECS642-210-0
- MOL File6398-98-7.mol
Chemical Properties
| RTECS | GO7300100 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in DMSO or methanol |
| form | Solid |
| color | White to Yellow to Orange |
| λmax | 342nm(MeOH)(lit.) |
| Merck | 14,572 |
| Stability | Hygroscopic |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C20H22ClN3O.ClH.H2O/c1-3-24(4-2)13-14-11-16(6-8-20(14)25)23-18-9-10-22-19-12-15(21)5-7-17(18)19;;/h5-12,25H,3-4,13H2,1-2H3,(H,22,23);1H;1H2 |
| InChIKey | AOFIMJMWPZOPAJ-UHFFFAOYSA-N |
| SMILES | N(C1C=CC(O)=C(CN(CC)CC)C=1)C1=CC=NC2=CC(Cl)=CC=C12.Cl.O |
| CAS DataBase Reference | 6398-98-7(CAS DataBase Reference) |
