![1-[(2,5-dimethoxyphenyl)azo]-2-naphthol Structure](/CAS/GIF/6358-53-8.gif)
1-[(2,5-dimethoxyphenyl)azo]-2-naphthol
- Product Name1-[(2,5-dimethoxyphenyl)azo]-2-naphthol
- CAS6358-53-8
- MFC18H16N2O3
- MW308.33
- EINECS228-778-9
- MOL File6358-53-8.mol
Chemical Properties
| Melting point | 155-157° |
| Boiling point | 448.73°C (rough estimate) |
| Density | 1.2510 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | 2-8°C |
| pka | 13.61±0.50(Predicted) |
| Colour Index | 12156 |
| BRN | 4510811 |
| Henry's Law Constant | 1.9×107 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C18H16N2O3/c1-22-13-8-10-17(23-2)15(11-13)19-20-18-14-6-4-3-5-12(14)7-9-16(18)21/h3-11,21H,1-2H3 |
| InChIKey | GJUABKCEXOMRPQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(c1)N=Nc2c(O)ccc3ccccc23 |
| LogP | 3.129 (est) |
| IARC | 2B (Vol. 8, Sup 7) 1987 |
| EPA Substance Registry System | Citrus Red No. 2 (6358-53-8) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 40 |
| Safety Statements | 45 |
| WGK Germany | 3 |
| RTECS | QL3675000 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 |
| Hazardous Substances Data | 6358-53-8(Hazardous Substances Data) |
| Toxicity | citrus red is a color used for coloring the skin of mature oranges. This compound has been described as being carcinogenic. |
